
Tris(trimethylsilyl) borate
한글명:Tris(trimethylsilyl) borate
카스 번호4325-85-3
상품명:Tris(trimethylsilyl) borate
CBNumberCB3733453
분자식C9H27BO3Si3
포뮬러 무게278.38
MOL 파일4325-85-3.mol
화학적 성질
녹는점 | -35°C |
끓는 점 | 186 °C (lit.) |
밀도 | 0.831 g/mL at 25 °C (lit.) |
굴절률 | n |
인화점 | 109 °F |
저장 조건 | Inert atmosphere,2-8°C |
물리적 상태 | 액체 |
Specific Gravity | 0.828 |
색상 | 무색의 |
Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
감도 | Moisture Sensitive |
BRN | 1772733 |
InChI | InChI=1S/C9H27BO3Si3/c1-14(2,3)11-10(12-15(4,5)6)13-16(7,8)9/h1-9H3 |
InChIKey | YZYKZHPNRDIPFA-UHFFFAOYSA-N |
SMILES | [Si](C)(C)(C)OB(O[Si](C)(C)C)O[Si](C)(C)C |
CAS 데이터베이스 | 4325-85-3 |
EPA | Silanol, trimethyl-, triester with boric acid (H3BO3) (4325-85-3) |
위험품 표기 | Xi | |||||||||
위험 카페고리 넘버 | 10-36/37/38 | |||||||||
안전지침서 | 26-36 | |||||||||
유엔번호(UN No.) | UN 1993 3/PG 3 | |||||||||
WGK 독일 | 3 | |||||||||
F 고인화성물질 | 10-21 | |||||||||
TSCA | Yes | |||||||||
위험 등급 | 3 | |||||||||
포장분류 | III | |||||||||
HS 번호 | 29319090 | |||||||||
NFPA 704: |
|