Didecyl phthalate
- Product NameDidecyl phthalate
- CAS84-77-5
- CBNumberCB9854462
- MFC28H46O4
- MW446.66
- EINECS201-561-6
- MDL NumberMFCD00041915
- MOL File84-77-5.mol
Chemical Properties
| Melting point: | 4 °C |
| Boiling point: | 245 °C/3 mmHg |
| Density | 0.96 |
| refractive index | 1.479-1.484 |
| Flash point: | 200 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Yellow |
| Water Solubility | 0.33mg/L(24 ºC) |
| BRN | 1893077 |
| Henry's Law Constant | 4.6×10-2 mol/(m3Pa) at 25℃, Cousins and Mackay (2000) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C28H46O4/c1-3-5-7-9-11-13-15-19-23-31-27(29)25-21-17-18-22-26(25)28(30)32-24-20-16-14-12-10-8-6-4-2/h17-18,21-22H,3-16,19-20,23-24H2,1-2H3 |
| InChIKey | PGIBJVOPLXHHGS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCCCC |
| CAS DataBase Reference | 84-77-5(CAS DataBase Reference) |
| EPA Substance Registry System | Didecyl phthalate (84-77-5) |
Safety
| Symbol(GHS) |
 GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | TI0900000 |
| TSCA | TSCA listed |
| HS Code | 2917349000 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 84-77-5(Hazardous Substances Data) |