4'-Chloropropiophenone
- Product Name4'-Chloropropiophenone
- CAS6285-05-8
- CBNumberCB9854028
- MFC9H9ClO
- MW168.62
- EINECS228-511-6
- MDL NumberMFCD00045214
- MOL File6285-05-8.mol
Chemical Properties
| Melting point: | 35-37 °C(lit.) |
| Boiling point: | 95-97 °C1 mm Hg(lit.) |
| Density | 1.151 |
| refractive index | 1.5325-1.5345 |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Insoluble |
| BRN | 1100638 |
| InChI | InChI=1S/C9H9ClO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | ADCYRBXQAJXJTD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(=O)CC |
| LogP | 2.4 |
| CAS DataBase Reference | 6285-05-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanone, 1-(4-chlorophenyl)-(6285-05-8) |
| EPA Substance Registry System | 1-Propanone, 1-(4-chlorophenyl)- (6285-05-8) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 37/39-26-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | UG9275000 | |||||||||
| TSCA | TSCA listed | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|