2-Chloropropene
- Product Name2-Chloropropene
- CAS557-98-2
- CBNumberCB9853829
- MFC3H5Cl
- MW76.52
- EINECS209-187-5
- MDL NumberMFCD00000859
- MOL File557-98-2.mol
Chemical Properties
| Melting point: | −137.4 °C (−215.3 °F; 135.8 K) |
| Boiling point: | 22.6 °C (72.7 °F; 295.8 K) |
| Density | 0.9017 g/mL (20 °C) |
| refractive index | n 20/D 1.395 (lit.) |
| Flash point: | -20 °C - closed cup |
| storage temp. | 2-8°C |
| form | gas |
| color | colorless |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1361376 |
| Henry's Law Constant | 1.4×10-4 mol/(m3Pa) at 25℃, HSDB (2015) |
| InChI | InChI=1S/C3H5Cl/c1-3(2)4/h1H2,2H3 |
| InChIKey | PNLQPWWBHXMFCA-UHFFFAOYSA-N |
| SMILES | C=C(Cl)C |
| CAS DataBase Reference | 557-98-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloropropene (557-98-2) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H319-H224 | |||||||||
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P337+P313-P305+P351+P338-P303+P361+P353-P403+P235 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | F+,Xi | |||||||||
| Risk Statements | 12-36/37 | |||||||||
| Safety Statements | 16-26-36 | |||||||||
| RIDADR | UN 2456 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | UC7200000 | |||||||||
| F | 10-23 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 2903299090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 1 STOT SE 3 |
|||||||||
| Hazardous Substances Data | 557-98-2(Hazardous Substances Data) | |||||||||
| Limited Quantities | 0.5 L (0.1 gallon) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (300g or 300ml) | |||||||||
| NFPA 704: |
|