
557-98-2
| Name | 2-Chloropropene |
| CAS | 557-98-2 |
| EINECS(EC#) | 209-187-5 |
| Molecular Formula | C3H5Cl |
| MDL Number | MFCD00000859 |
| Molecular Weight | 76.52 |
| MOL File | 557-98-2.mol |
Chemical Properties
| Appearance | CLEAR COLOURLESS LIQUID |
| Melting point | -138 °C |
| Boiling point | 23 °C |
| density | 0.91 |
| refractive index | n |
| Fp | -20°C |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1361376 |
| InChI | InChI=1S/C3H5Cl/c1-3(2)4/h1H2,2H3 |
| InChIKey | PNLQPWWBHXMFCA-UHFFFAOYSA-N |
| SMILES | C=C(Cl)C |
| CAS DataBase Reference | 557-98-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloropropene (557-98-2) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H224-H319-H335 |
| Precautionary statements | P210-P305+P351+P338-P403+P233 |
| Hazard Codes | F+,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2456 3/PG 1 |
| WGK Germany | 3 |
| RTECS | UC7200000 |
| F | 10-23 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | I |
| HS Code | 2903290000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 1 STOT SE 3 |
| Safety Profile | |
| Hazardous Substances Data | 557-98-2(Hazardous Substances Data) |

