2,6-Difluoroanisole
- Product Name2,6-Difluoroanisole
- CAS437-82-1
- CBNumberCB9782190
- MFC7H6F2O
- MW144.12
- MDL NumberMFCD00142846
- MOL File437-82-1.mol
Chemical Properties
| Boiling point: | 70-72°C 56mm |
| Density | 1.221 |
| refractive index | 1.4570 to 1.4620 |
| Flash point: | 61°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.2350 |
| InChI | InChI=1S/C7H6F2O/c1-10-7-5(8)3-2-4-6(7)9/h2-4H,1H3 |
| InChIKey | IOBWAHRFIPQEQL-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1OC |
| CAS DataBase Reference | 437-82-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 16-26-36 | |||||||||
| RIDADR | 1993 | |||||||||
| Hazard Note | Flammable | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2909309090 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|