meso-2,3-Dibromosuccinic acid
- Product Namemeso-2,3-Dibromosuccinic acid
- CAS608-36-6
- CBNumberCB9764709
- MFC4H4Br2O4
- MW275.88
- EINECS208-396-9
- MDL NumberMFCD00066439
- MOL File608-36-6.mol
Chemical Properties
| Melting point: | 288-290 °C(lit.) |
| Boiling point: | 262.4±40.0 °C(Predicted) |
| Density | 2.486±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 20 g/L (17°C) |
| form | Powder |
| pka | pK1:1.51;pK2:2.71 (20°C) |
| color | White to pale yellow to beige |
| Water Solubility | 20 g/L (17 ºC) |
| Merck | 14,3029 |
| BRN | 1725173 |
| InChI | 1S/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/t1-,2+ |
| InChIKey | FJWGRXKOBIVTFA-XIXRPRMCSA-N |
| SMILES | OC(=O)[C@@H](Br)[C@@H](Br)C(O)=O |
| CAS DataBase Reference | 608-36-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-45-24/25 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2917190090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| REACH Registrations | Inactive | |||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|