KETOPROFEN-D3
- Product NameKETOPROFEN-D3
- CAS159490-55-8
- CBNumberCB9740518
- MFC16H14O3
- MW254.29
- MDL NumberMFCD08063452
- MOL FileMol file
Chemical Properties
| storage temp. | Store at -20°C |
| solubility | DMSO: soluble; Methanol: soluble |
| form | Solid |
| color | White to off-white |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/i1D3 |
| InChIKey | DKYWVDODHFEZIM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(O)=O)c1cccc(c1)C(=O)c2ccccc2 |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25-36/37/38 | |||||||||
| Safety Statements | 26-45 | |||||||||
| RIDADR | UN 2811 6.1 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|