159490-55-8
| Name | KETOPROFEN-D3 |
| CAS | 159490-55-8 |
| Molecular Formula | C16H14O3 |
| MDL Number | MFCD08063452 |
| Molecular Weight | 254.29 |
| MOL File | 159490-55-8.mol |
Chemical Properties
| storage temp. | Store at -20°C |
| solubility | DMSO: soluble; Methanol: soluble |
| form | neat |
| color | White to off-white |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C16H14O3/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12/h2-11H,1H3,(H,18,19)/i1D3 |
| InChIKey | DKYWVDODHFEZIM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(O)=O)c1cccc(c1)C(=O)c2ccccc2 |
Safety Data
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |