Cyclohexane-d12
- Product NameCyclohexane-d12
- CAS1735-17-7
- CBNumberCB9720820
- MFC6D12
- MW96.23
- EINECS217-077-3
- MDL NumberMFCD00044212
- MOL File1735-17-7.mol
Chemical Properties
| Melting point: | 6,47°C |
| Melting point: | 6.5 °C (lit.) |
| Boiling point: | 80,7°C |
| Boiling point: | 80.7 °C |
| Density | 0.89 |
| Density | d = 0,89 |
| refractive index | n 20/D 1.421 (lit.) |
| Flash point: | -18 °C |
| storage temp. | Flammables area |
| solubility | 55mg/l insoluble |
| form | clear liquid |
| color | Colorless |
| Solvent Residual Peak | 1H NMR：1.38 ppm (s) 13C NMR：26.43 ppm (quint) |
| explosive limit | 1.2-8.3%(V) |
| Water Solubility | Insoluble in water. |
| BRN | 1908842 |
| Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. Note low flash point. Protect from moisture. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H12/c1-2-4-6-5-3-1/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2 |
| InChIKey | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| SMILES | C1([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| CAS DataBase Reference | 1735-17-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
    GHS02,GHS07,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H304-H315-H336-H410 | |||||||||
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 | |||||||||
| target organs | Central nervous system | |||||||||
| Hazard Codes | F,Xn,N | |||||||||
| Risk Statements | 11-38-50/53-65-67 | |||||||||
| Safety Statements | 9-16-25-33-60-61-62-51 | |||||||||
| RIDADR | UN 1145 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 9 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2902110000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|