3,4-Difluorobenzotrifluoride
- Product Name3,4-Difluorobenzotrifluoride
- CAS32137-19-2
- CBNumberCB9716748
- MFC7H3F5
- MW182.09
- EINECS608-708-7
- MDL NumberMFCD00077510
- MOL File32137-19-2.mol
Chemical Properties
| Melting point: | 95-98 °C |
| Boiling point: | 102 °C |
| Density | 1.41 |
| refractive index | 1.39 |
| Flash point: | 25 °C |
| storage temp. | Sealed in dry,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| BRN | 1950149 |
| InChI | InChI=1S/C7H3F5/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H |
| InChIKey | MVCGQTYWLZSKSB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 32137-19-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | Xi-F,F,Xi | |||||||||
| Risk Statements | 36/37/38-11 | |||||||||
| Safety Statements | 37/39-26-16-36 | |||||||||
| RIDADR | 1993 | |||||||||
| Hazard Note | Flammable | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2903999090 | |||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|