3-Chloro-2,4-difluoronitrobenzene
- Product Name3-Chloro-2,4-difluoronitrobenzene
- CAS3847-58-3
- CBNumberCB9706068
- MFC6H2ClF2NO2
- MW193.54
- EINECS411-980-8
- MDL NumberMFCD00042201
- MOL File3847-58-3.mol
Chemical Properties
| Melting point: | 41-43°C |
| Boiling point: | 243.0±35.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C6H2ClF2NO2/c7-5-3(8)1-2-4(6(5)9)10(11)12/h1-2H |
| InChIKey | CTVBVNKEMCGZDF-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C([N+]([O-])=O)C(F)=C1Cl |
| CAS DataBase Reference | 3847-58-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
   GHS05,GHS07,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H314-H317-H410-H318-H400 | |||||||||
| Precautionary statements | P260-P264-P270-P272-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P391-P405-P501-P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P501a | |||||||||
| Hazard Codes | C,N | |||||||||
| Risk Statements | 20/21/22-50/53-43-34-22 | |||||||||
| Safety Statements | 36/37/39-45-61-60-28-26-22 | |||||||||
| RIDADR | 1759 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2904990090 | |||||||||
| REACH Registrations | Inactive | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
