2'-Hydroxy-5'-methyl-3'-nitroacetophenone
- Product Name2'-Hydroxy-5'-methyl-3'-nitroacetophenone
- CAS66108-30-3
- CBNumberCB9703052
- MFC9H9NO4
- MW195.17
- MDL NumberMFCD00192216
- MOL File66108-30-3.mol
Chemical Properties
| Melting point: | 133-136 °C(lit.) |
| Boiling point: | 254.0±35.0 °C(Predicted) |
| Density | 1.323±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 7+-.0.38(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H9NO4/c1-5-3-7(6(2)11)9(12)8(4-5)10(13)14/h3-4,12H,1-2H3 |
| InChIKey | XSHQMMIEZHWNAK-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(C)=CC([N+]([O-])=O)=C1O)C |
| CAS DataBase Reference | 66108-30-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|