1,3,5-Trifluorobenzene
- Product Name1,3,5-Trifluorobenzene
- CAS372-38-3
- CBNumberCB9690716
- MFC6H3F3
- MW132.08
- EINECS206-751-2
- MDL NumberMFCD00000333
- MOL File372-38-3.mol
Chemical Properties
| Melting point: | -5.5 °C (lit.) |
| Boiling point: | 75-76 °C (lit.) |
| Density | 1.277 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 19 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| Specific Gravity | 1.277 |
| color | Colorless to Almost colorless |
| Water Solubility | Insoluble in water. |
| BRN | 1906457 |
| InChI | InChI=1S/C6H3F3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | JXUKFFRPLNTYIV-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 372-38-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Trifluorobenzene(372-38-3) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 11-36/37/38 | |||||||||
| Safety Statements | 16-26-36-7-33-29-7/9 | |||||||||
| RIDADR | UN 1993 3/PG 2 | |||||||||
| WGK Germany | 2 | |||||||||
| Hazard Note | Flammable | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29039990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
