2',3',4',5',6'-Pentafluoroacetophenone
- Product Name2',3',4',5',6'-Pentafluoroacetophenone
- CAS652-29-9
- CBNumberCB6470221
- MFC8H3F5O
- MW210.1
- EINECS211-487-6
- MDL NumberMFCD00000296
- MOL File652-29-9.mol
Chemical Properties
| Melting point: | 130.5 °C |
| Boiling point: | 131 °C |
| Density | 1.51 |
| refractive index | 1.44 |
| Flash point: | 66 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.476 |
| BRN | 2053225 |
| InChI | 1S/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
| InChIKey | FBGHCYZBCMDEOX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(F)c(F)c(F)c(F)c1F |
| CAS DataBase Reference | 652-29-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H227-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | F | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Flammable | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|