N-Methylisatin
- Product NameN-Methylisatin
- CAS2058-74-4
- CBNumberCB9480285
- MFC9H7NO2
- MW161.16
- EINECS218-164-9
- MDL NumberMFCD00005812
- MOL File2058-74-4.mol
Chemical Properties
| Melting point: | 130-133 °C (lit.) |
| Boiling point: | 287.44°C (rough estimate) |
| Density | 1.314 |
| refractive index | 1.5050 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -2.41±0.20(Predicted) |
| form | Crystalline Powder |
| color | Orange to brownish |
| Water Solubility | Insoluble in water. |
| λmax | 427nm(CH2Cl2)(lit.) |
| BRN | 128280 |
| InChI | InChI=1S/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
| InChIKey | VCYBVWFTGAZHGH-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C(=O)C1=O |
| CAS DataBase Reference | 2058-74-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25-37/38-41 | |||||||||
| Safety Statements | 26-39-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NL7939000 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29337900 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Toxicity | mouse,LD50,intraperitoneal,685mg/kg (685mg/kg),LUNGS, THORAX, OR RESPIRATION: RESPIRATORY STIMULATION,Pharmaceutical Chemistry Journal Vol. 15, Pg. 858, 1981. | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|