L-Cystine dihydrochloride
- Product NameL-Cystine dihydrochloride
- CAS30925-07-6
- CBNumberCB9147199
- MFC6H13ClN2O4S2
- MW276.75
- EINECS250-391-9
- MDL NumberMFCD00070399
- MOL File30925-07-6.mol
Chemical Properties
| Melting point: | 228-232℃ |
| alpha | [α]D20 -165～-175° (c=1, dil. HCl) |
| Density | 1.518[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 0.5 M HCl: 50 mg/mL |
| form | Powder |
| color | White to Pale Yellow |
| Odor | odorless |
| biological source | synthetic |
| optical activity | [α]20/D -174 to -164 °, c =2 in 1 M HCl |
| Water Solubility | Soluble in hydrochloric acid. (0.5 M HCl: 50 mg/mL) Soluble in water. |
| InChI | InChI=1/C6H12N2O4S2.ClH/c7-3(5(9)10)1-13-14-2-4(8)6(11)12;/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12);1H/t3-,4-;/s3 |
| InChIKey | IOCJWNPYGRVHLN-QYDODFSFNA-N |
| SMILES | [C@@H](N)(C(=O)O)CSSC[C@H](N)C(=O)O.Cl |&1:0,9,r| |
| LogP | -5.08 at 25℃ |
| CAS DataBase Reference | 30925-07-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2930909099 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
| REACH Registrations | Active |