D-Fructose 6-phosphate disodium salt
- Product NameD-Fructose 6-phosphate disodium salt
- CAS26177-86-6
- CBNumberCB8767248
- MFC6H11Na2O9P
- MW304.1
- EINECS247-505-4
- MDL NumberMFCD00135619
- MOL File26177-86-6.mol
Chemical Properties
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear to slightly hazy, colorless to faintly yellow |
| form | amorphous powder |
| color | White to Off-white |
| Water Solubility | Soluble in water (100 mg/ml). |
| BRN | 5686786 |
| Stability: | Hygroscopic |
| Major Application | agriculture |
| InChI | InChI=1/C6H13O9P.2Na/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h4-7,9-11H,1-2H2,(H2,12,13,14);;/q;2*+1/p-2/t4-,5-,6-;;/s3 |
| InChIKey | WJTRLMLMSLDAPQ-SSBKGMACNA-L |
| SMILES | [C@@H](O)([C@H](O)COP([O-])([O-])=O)[C@H](O)C(=O)CO.[Na+].[Na+] |&1:0,2,10,r| |
| CAS DataBase Reference | 26177-86-6(CAS DataBase Reference) |
| EPA Substance Registry System | D-Fructose, 6-(dihydrogen phosphate), disodium salt (26177-86-6) |
Safety
| Symbol(GHS) |
 GHS08 |
| Signal word | Warning |
| Hazard statements | H371 |
| Precautionary statements | P260-P264-P270-P308+P311-P405-P501 |
| Hazard Codes | Xn,C |
| Risk Statements | 20/21/22-68/20/21/22-34 |
| Safety Statements | 36/37-45-36/37/39-27-26 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 |