2,4,6-Trimethylbenzoyl chloride
- Product Name2,4,6-Trimethylbenzoyl chloride
- CAS938-18-1
- CBNumberCB8760779
- MFC10H11ClO
- MW182.65
- EINECS213-339-6
- MDL NumberMFCD00013650
- MOL File938-18-1.mol
Chemical Properties
| Boiling point: | 143-146 °C (60 mmHg) |
| Density | 1.095 g/mL at 25 °C |
| vapor pressure | 1.52Pa at 25℃ |
| refractive index | 1.528-1.53 |
| Flash point: | 143-146°C/60mm |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear light yellow |
| Water Solubility | Reacts slowly with water. |
| Sensitive | Moisture Sensitive |
| BRN | 776108 |
| InChI | InChI=1S/C10H11ClO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=C(C)C=C(C)C=C1C |
| LogP | 2.42-3.65 at 25℃ |
| CAS DataBase Reference | 938-18-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4,6-Trimethylbenzoyl chloride(938-18-1) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 45-36/37/39-26 | |||||||||
| RIDADR | 1760 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2916399090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|