1,2-Diethylbenzene
- Product Name1,2-Diethylbenzene
- CAS135-01-3
- CBNumberCB8718972
- MFC10H14
- MW134.22
- EINECS205-170-1
- MDL NumberMFCD00009258
- MOL File135-01-3.mol
Chemical Properties
| Melting point: | −31 °C (lit.) |
| Boiling point: | 183 °C (lit.) |
| Density | 0.88 g/mL at 25 °C (lit.) |
| refractive index | n 20/D 1.502 (lit.) || n 20/D 1.503 |
| Flash point: | 55 °C - closed cup |
| solubility | soluble in DMSO, Methanol |
| form | liquid |
| color | Clear Colorless |
| Odor Threshold | 0.0094ppm |
| Water Solubility | Miscible with alcohol, benzene and carbon tetrachloride. Immiscible with water. |
| Thermal Conductivity | 0.133 W/(m·K) at 25 ℃ |
| BRN | 1904392 |
| Henry's Law Constant | 3.8×10-3 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI | InChI=1S/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | KVNYFPKFSJIPBJ-UHFFFAOYSA-N |
| SMILES | C1(CC)=CC=CC=C1CC |
| LogP | 3.720 |
| CAS DataBase Reference | 135-01-3(CAS DataBase Reference) |
| EPA Substance Registry System | o-Diethylbenzene (135-01-3) |
Safety
| Symbol(GHS) |
    GHS02,GHS07,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H304-H315-H319-H335-H411 | |||||||||
| Precautionary statements | P210-P233-P240-P241-P242-P243-P280-P264-P261-P271-P273-P303+P361+P353-P370+P378-P301+P310-P331-P302+P352-P332+P313-P362+P364-P305+P351+P338-P337+P313-P304+P340-P312-P391-P403+P235-P405-P403+P233-P501 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 2049 3/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | CZ5640000 | |||||||||
| Autoignition Temperature | 743 °F | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2902909000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| Hazardous Substances Data | 135-01-3(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|