(3-Bromoacetyl)coumarin
- Product Name(3-Bromoacetyl)coumarin
- CAS29310-88-1
- CBNumberCB8469841
- MFC11H7BrO3
- MW267.08
- MDL NumberMFCD00488331
- MOL File29310-88-1.mol
Chemical Properties
| Melting point: | 164-168 °C (lit.) |
| Boiling point: | 424.6±45.0 °C(Predicted) |
| Density | 1.674±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| λmax | 363nm(MeOH)(lit.) |
| InChI | 1S/C11H7BrO3/c12-6-9(13)8-5-7-3-1-2-4-10(7)15-11(8)14/h1-5H,6H2 |
| InChIKey | NTYOLVNSXVYRTJ-UHFFFAOYSA-N |
| SMILES | BrCC(=O)C1=Cc2ccccc2OC1=O |
| CAS DataBase Reference | 29310-88-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-36/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2932209090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 |