2-Furanacrolein
- Product Name2-Furanacrolein
- CAS623-30-3
- CBNumberCB8450890
- MFC7H6O2
- MW122.12
- EINECS210-785-3
- MDL NumberMFCD00003256
- MOL File623-30-3.mol
Chemical Properties
| Melting point: | 49-55 °C(lit.) |
| Boiling point: | 143 °C37 mm Hg(lit.) |
| Density | 1.1483 (rough estimate) |
| refractive index | 1.5286 (estimate) |
| FEMA | 2494 | 3-(2-FURYL)ACROLEIN |
| Flash point: | 211 °F |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Dark green |
| Odor | at 1.00 % in dipropylene glycol. green grassy fruity spicy vanilla nutty woody cinnamon |
| Odor Type | spicy |
| biological source | synthetic |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| JECFA Number | 1497 |
| BRN | 107570 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C7H6O2/c8-5-1-3-7-4-2-6-9-7/h1-6H/b3-1+ |
| InChIKey | VZIRCHXYMBFNFD-HNQUOIGGSA-N |
| SMILES | [H]C(=O)\C([H])=C(/[H])c1ccco1 |
| LogP | 1.74 |
| CAS DataBase Reference | 623-30-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenal, 3-(2-furanyl)-(623-30-3) |
| EPA Substance Registry System | 2-Propenal, 3-(2-furanyl)- (623-30-3) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H318-H302-H314 | |||||||||
| Precautionary statements | P260-P264-P270-P271-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P501a | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-27-28-36/37/39-45-24/25 | |||||||||
| RIDADR | UN 1759 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | LT8528500 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2932190090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
|||||||||
| NFPA 704: |
|