Sulfur trioxide-triethylamine complex
- Product NameSulfur trioxide-triethylamine complex
- CAS761-01-3
- CBNumberCB8416582
- MFC6H15N.O3S
- MW181.25
- MDL NumberMFCD00043315
- MOL File761-01-3.mol
Chemical Properties
| Melting point: | ~85 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| BRN | 3993165 |
| InChI | InChI=1S/C6H15N.O3S/c1-4-7(5-2)6-3;1-4(2)3/h4-6H2,1-3H3; |
| InChIKey | YYHPEVZFVMVUNJ-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)=O.N(CC)(CC)CC |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2921199090 | |||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|