Dibucaine hydrochloride
- Product NameDibucaine hydrochloride
- CAS61-12-1
- CBNumberCB8358372
- MFC20H30ClN3O2
- MW379.92
- EINECS200-498-1
- MDL NumberMFCD00012735
- MOL File61-12-1.mol
Chemical Properties
| Melting point: | 99-101 °C(lit.) |
| Density | 1.1338 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Hygroscopic crystals |
| PH | pH(20g/l,25℃) : 5.0～6.0 |
| Water Solubility | Freely soluble in water, alcohol, acetone, or chloroform |
| Merck | 13,3057 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Protect from moisture. |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C20H29N3O2.ClH/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3;/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24);1H |
| InChIKey | IVHBBMHQKZBJEU-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC1=NC(OCCCC)=CC=2C(=O)NCCN(CC)CC.Cl |
| CAS DataBase Reference | 61-12-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| RTECS | GD3325000 |
| HS Code | 2933492250 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | eye-rbt 2% SEV ARZNAD 8,181,58 |