5-Hexenoic acid methyl ester
- Product Name5-Hexenoic acid methyl ester
- CAS2396-80-7
- CBNumberCB8214131
- MFC7H12O2
- MW128.17
- MDL NumberMFCD00671538
- MOL File2396-80-7.mol
Chemical Properties
| Boiling point: | 157 °C |
| Density | 0,91 g/cm3 |
| refractive index | n20/D 1.421 |
| Flash point: | 46°C |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C7H12O2/c1-3-4-5-6-7(8)9-2/h3H,1,4-6H2,2H3 |
| InChIKey | ASKDFGVMJZMYEM-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CCCC=C |
| LogP | 1.890 (est) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H302 | |||||||||
| Precautionary statements | P210-P301+P312+P330 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 36/37/38-10-22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | UN3272 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2916190090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Flam. Liq. 3 |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|