(-)-Verbenone
- Product Name(-)-Verbenone
- CAS1196-01-6
- CBNumberCB7737787
- MFC10H14O
- MW150.22
- EINECS214-807-2
- MDL NumberMFCD00065445
- MOL File1196-01-6.mol
Chemical Properties
| Boiling point: | 227-228 °C (lit.) |
| Density | 0.975 g/mL at 20 °C (lit.) |
| FEMA | 4216 | VERBENONE |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethanol (Slightly) |
| form | Liquid |
| color | Clear light yellow to yellow |
| Specific Gravity | 0.97 |
| Odor | at 100.00 %. spicy mint camphor |
| Odor Type | spicy |
| biological source | synthetic |
| optical activity | [α]25/D 130°, c = 10 in ethanol |
| BRN | 1907623 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | 1S/C10H14O/c1-6-4-9(11)8-5-7(6)10(8,2)3/h4,7-8H,5H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | DCSCXTJOXBUFGB-JGVFFNPUSA-N |
| SMILES | CC1=CC(=O)[C@H]2C[C@@H]1C2(C)C |
| LogP | 2.230 |
| CAS DataBase Reference | 1196-01-6(CAS DataBase Reference) |
| EPA Substance Registry System | Verbenone (1196-01-6) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Safety Statements | 24/25 | |||||||||
| RIDADR | NA 1993 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29142900 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Excepted Quantities | Non-Hazardous | |||||||||
| NFPA 704: |
|