3-(4-Chlorophenyl)-1H-pyrazol-5-amine
- Product Name3-(4-Chlorophenyl)-1H-pyrazol-5-amine
- CAS78583-81-0
- CBNumberCB7724985
- MFC9H8ClN3
- MW193.63
- MDL NumberMFCD00053046
- MOL File78583-81-0.mol
Chemical Properties
| Melting point: | 172-176 °C(lit.) |
| Boiling point: | 463.8±35.0 °C(Predicted) |
| Density | 1.378±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.08±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13) |
| InChIKey | XQPBZIITFQHIDI-UHFFFAOYSA-N |
| SMILES | Nc1cc(n[nH]1)-c2ccc(Cl)cc2 |
| CAS DataBase Reference | 78583-81-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 22-37/38-41 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2933199090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|