ACETONE-D6
- Product NameACETONE-D6
- CAS666-52-4
- CBNumberCB7693142
- MFC3D6O
- MW64.12
- EINECS211-563-9
- MDL NumberMFCD00044635
- MOL File666-52-4.mol
Chemical Properties
| Melting point: | -94°C |
| Melting point: | −94 °C (−137 °F; 179 K) |
| Boiling point: | 56 °C (133 °F; 329 K) |
| Boiling point: | 56,5°C |
| Density | d = 0,87 |
| Density | 0.872 g cm−3 |
| vapor density | 2 (vs air) |
| vapor pressure | 14.39 psi ( 55 °C) |
| refractive index | 1.36 |
| Flash point: | −19 °C (−2 °F; 254 K) |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless |
| Specific Gravity | 0.872 |
| PH | 5-6 (365g/l, H2O) |
| Solvent Residual Peak | 1H NMR：2.05 ppm (quint) 13C NMR：206.26±0.13 ppm(C=O, s), 29.84±0.01 ppm (CH₃, sept) |
| Odor | Peculiar odor |
| explosive limit | 2.6-12.8%(V) |
| Water Solubility | Soluble in water. |
| BRN | 1702935 |
| Stability: | Stable. Highly flammable. Readily forms explosive mixtures with air. Note low flashpoint and wide explosion limits. Incompatible with bases, oxidising agents, strong acids, reducing agents. Protect from moisture. |
| InChI | 1S/C3H6O/c1-3(2)4/h1-2H3/i1D3,2D3 |
| InChIKey | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] |
| CAS DataBase Reference | 666-52-4(CAS DataBase Reference) |
| EPA Substance Registry System | Acetone-d6 (666-52-4) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H319-H336 | |||||||||
| Precautionary statements | P210-P233-P240-P241-P242-P305+P351+P338 | |||||||||
| target organs | Central nervous system | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 11-36-66-67 | |||||||||
| Safety Statements | 9-16-26-33-23 | |||||||||
| RIDADR | UN 1090 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Autoignition Temperature | 465 °C DIN 51794 | |||||||||
| HS Code | 2845900010 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
|||||||||
| Toxicity | LD50 orally in Rabbit: 5800 mg/kg LD50 dermal Rabbit 20000 mg/kg | |||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|