cis-Bis(isothiocyanato)bis(2,2-bipyridyl-4,4-dicarboxylato)-ruthenium(II)
- Product Namecis-Bis(isothiocyanato)bis(2,2-bipyridyl-4,4-dicarboxylato)-ruthenium(II)
- CAS141460-19-7
- CBNumberCB7500802
- MF2C12H8N2O4.C2N2RuS2
- MW705.648
- MDL NumberMFCD11042213
- MOL File141460-19-7.mol
Chemical Properties
| Melting point: | >300°C |
| form | powder to crystal |
| color | Gray to Dark purple to Black |
| λmax | 534395312 nm (lit.) |
| InChI | 1S/2C12H8N2O4.2CNS.Ru/c2*15-11(16)7-1-3-13-9(5-7)10-6-8(12(17)18)2-4-14-10;2*2-1-3;/h2*1-6H,(H,15,16)(H,17,18);;;/q;;2*-1;+2 |
| InChIKey | VMISXESAJBVFNH-UHFFFAOYSA-N |
| SMILES | S=C=N[Ru]N=C=S.OC(=O)c1ccnc(c1)-c2cc(ccn2)C(O)=O.OC(=O)c3ccnc(c3)-c4cc(ccn4)C(O)=O |
| solubility | Ethanol |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2843900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |