Triclosan methyl ether
- Product NameTriclosan methyl ether
- CAS4640-01-1
- CBNumberCB7484274
- MFC13H9Cl3O2
- MW303.57
- MDL NumberMFCD04039700
- MOL File4640-01-1.mol
Chemical Properties
| Melting point: | 210-217 °C |
| Boiling point: | 210-217 °C |
| Density | 1.380±0.06 g/cm3(Predicted) |
| Flash point: | Not applicable |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated), Methanol (Slightly) |
| form | Oil to Solid |
| color | Colourless to Off-White |
| Major Application | cleaning products clinical cosmetics food and beverages forensics and toxicology personal care pharmaceutical (small molecule) |
| InChI | 1S/C13H9Cl3O2/c1-17-13-7-9(15)3-5-12(13)18-11-4-2-8(14)6-10(11)16/h2-7H,1H3 |
| InChIKey | NLYDHBBTVWMLFD-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)ccc1Oc2ccc(Cl)cc2Cl |
| EPA Substance Registry System | Benzene, 4-chloro-1-(2,4-dichlorophenoxy)-2-methoxy- (4640-01-1) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | WGK 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 1 |