Benzoin methyl ether
- Product NameBenzoin methyl ether
- CAS3524-62-7
- CBNumberCB7428294
- MFC15H14O2
- MW226.27
- EINECS222-538-7
- MDL NumberMFCD00008492
- MOL File3524-62-7.mol
Chemical Properties
| Melting point: | 47.5-48.5 °C (lit.) |
| Boiling point: | 188-189 °C (15 mmHg) |
| Density | 1.128 |
| refractive index | 1.6530 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder |
| color | White to Almost white |
| Merck | 14,1093 |
| BRN | 2052112 |
| InChI | 1S/C15H14O2/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12/h2-11,15H,1H3 |
| InChIKey | BQZJOQXSCSZQPS-UHFFFAOYSA-N |
| SMILES | COC(C(=O)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 3524-62-7(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 2-methoxy-1,2-diphenyl- (3524-62-7) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301 | |||||||||
| Precautionary statements | P301+P310 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AM9350000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 2914509090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| Toxicity | LD50 oral in mouse: 300mg/kg | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|