2-Chloro-3,5-dinitropyridine
- Product Name2-Chloro-3,5-dinitropyridine
- CAS2578-45-2
- CBNumberCB7337695
- MFC5H2ClN3O4
- MW203.54
- EINECS219-937-3
- MDL NumberMFCD00006233
- MOL File2578-45-2.mol
Chemical Properties
| Melting point: | 63-65 °C(lit.) |
| Boiling point: | 320.9±37.0 °C(Predicted) |
| Density | 2.2523 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -6.96±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 196026 |
| InChI | InChI=1S/C5H2ClN3O4/c6-5-4(9(12)13)1-3(2-7-5)8(10)11/h1-2H |
| InChIKey | QLHVJBXAQWPEDI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 2578-45-2(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridine, 2-chloro-3,5-dinitro- (2578-45-2) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300-H315-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P310-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | T,Xi | |||||||||
| Risk Statements | 25 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | US6504750 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2933399090 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| Storage Class |
6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
|||||||||
| Hazard Classifications |
Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 |
|||||||||
| Toxicity | LD50 orally in Rabbit: 50 mg/kg | |||||||||
| Limited Quantities | 0.5 Kg (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|