3-Chloro-4-methylphenol
- Product Name3-Chloro-4-methylphenol
- CAS615-62-3
- CBNumberCB7327980
- MFC7H7ClO
- MW142.58
- EINECS210-439-1
- MDL NumberMFCD00060319
- MOL File615-62-3.mol
Chemical Properties
| Melting point: | 48-53 °C |
| Boiling point: | 228 °C |
| Density | 0,963g/cm |
| refractive index | 1,403 |
| Flash point: | 228°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | 9.30±0.18(Predicted) |
| color | Light yellow to Amber to Dark green |
| λmax | 283nm(H2O)(lit.) |
| InChI | InChI=1S/C7H7ClO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 |
| InChIKey | VQZRLBWPEHFGCD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C(Cl)=C1 |
| CAS DataBase Reference | 615-62-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 3-chloro-4-methyl- (615-62-3) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | C,T,Xi,Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38-38-21/22-41-37/38 | |||||||||
| Safety Statements | 23-36/37/39-28-26-39 | |||||||||
| RIDADR | 3437 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic/Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2908199090 | |||||||||
| Storage Class | 13 - Non Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|