2-Propanol-d8
- Product Name2-Propanol-d8
- CAS22739-76-0
- CBNumberCB7300596
- MFC3D8O
- MW68.14
- EINECS245-189-2
- MDL NumberMFCD00044341
- MOL File22739-76-0.mol
Chemical Properties
| Melting point: | -89.5°C |
| Melting point: | -89°C |
| Boiling point: | 83°C |
| Boiling point: | 82 °C(lit.) |
| Density | 0.890 g/mL at 25 °C(lit.) |
| Density | d = 0,90 |
| refractive index | n |
| Flash point: | 75 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| explosive limit | 2-12.7%(V) |
| Water Solubility | Completely soluble in water. |
| BRN | 1816231 |
| Stability: | Stable. Highly flammable. Incompatible with acids, strong oxidizing agents, acid anhydrides, halogens, aluminium. |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D |
| InChIKey | KFZMGEQAYNKOFK-PIODKIDGSA-N |
| SMILES | C([2H])(O[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H319-H336 | |||||||||
| Precautionary statements | P210-P305+P351+P338 | |||||||||
| target organs | Central nervous system | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 11-67-36 | |||||||||
| Safety Statements | 7-16-26-24/25-2017/7/16 | |||||||||
| RIDADR | UN 1219 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 28459000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|