| Melting point: |
123-125 |
| Boiling point: |
443.6±25.0 °C(Predicted) |
| Density |
1.228±0.06 g/cm3(Predicted) |
| vapor pressure |
0.002Pa at 20℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Practically insoluble in water |
| form |
powder to crystal |
| pka |
-3.41±0.20(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
74.3mg/L at 20℃ |
| InChI |
InChI=1S/C14H11NO/c16-14-10-11-6-4-5-9-13(11)15(14)12-7-2-1-3-8-12/h1-9H,10H2 |
| InChIKey |
OWPNVXATCSXTBK-UHFFFAOYSA-N |
| SMILES |
N1(C2=CC=CC=C2)C2=C(C=CC=C2)CC1=O |
| LogP |
2.6 at 26℃ |
| CAS DataBase Reference |
3335-98-6(CAS DataBase Reference) |
