Mefexamide hydrochloride
- Product NameMefexamide hydrochloride
- CAS1227-61-8
- CBNumberCB7145984
- MFC15H24N2O3
- MW280.36
- EINECS214-963-1
- MDL NumberMFCD00868092
- MOL File1227-61-8.mol
Chemical Properties
| Boiling point: | 423.08°C (rough estimate) |
| Density | 1.0586 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | 1S/C15H24N2O3.ClH/c1-4-17(5-2)11-10-16-15(18)12-20-14-8-6-13(19-3)7-9-14;/h6-9H,4-5,10-12H2,1-3H3,(H,16,18);1H |
| InChIKey | AXBHPHPHZHAOAK-UHFFFAOYSA-N |
| SMILES | Cl.CCN(CC)CCNC(=O)COc1ccc(OC)cc1 |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 26/27/28 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | AB7175000 |
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |