Sodium phenoxyacetate
- Product NameSodium phenoxyacetate
- CAS3598-16-1
- CBNumberCB7104910
- MFC8H7NaO3
- MW174.13
- EINECS222-746-8
- MDL NumberMFCD00064234
- MOL File3598-16-1.mol
Chemical Properties
| Melting point: | 262-264°C |
| Boiling point: | 489℃[at 101 325 Pa] |
| Density | 1.498[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 3.17[at 20 ℃] |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | 223.6g/L at 20℃ |
| InChI | InChI=1S/C8H8O3.Na/c9-8(10)6-11-7-4-2-1-3-5-7;/h1-5H,6H2,(H,9,10);/q;+1/p-1 |
| InChIKey | WPTJBFNYRRZIDZ-UHFFFAOYSA-M |
| SMILES | [Na+].C([O-])(=O)COC1=CC=CC=C1 |
| LogP | -2.48 |
| CAS DataBase Reference | 3598-16-1(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, phenoxy-, sodium salt (3598-16-1) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AJ2400000 |
| TSCA | TSCA listed |
| HS Code | 2918.99.4700 |
| REACH Registrations | Active |