N,N-Dimethylglycine ethyl ester
- Product NameN,N-Dimethylglycine ethyl ester
- CAS33229-89-9
- CBNumberCB6853510
- MFC6H13NO2
- MW131.17
- EINECS251-411-9
- MDL NumberMFCD00009175
- MOL File33229-89-9.mol
Chemical Properties
| Melting point: | 135 °C |
| Boiling point: | 40 °C/6.8 mmHg |
| Density | 0.93 |
| refractive index | 1.41 |
| Flash point: | 32 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 7.37±0.28(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1750085 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Flammable. |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H13NO2/c1-4-9-6(8)5-7(2)3/h4-5H2,1-3H3 |
| InChIKey | BGCNBOFPABQGNG-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CN(C)C |
| CAS DataBase Reference | 33229-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | Glycine, N,N-dimethyl-, ethyl ester (33229-89-9) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315 | |||||||||
| Precautionary statements | P210-P302+P352 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 10-38 | |||||||||
| Safety Statements | 37-17-16 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | MB9990000 | |||||||||
| F | 3-8-9-23 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2922499990 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Flam. Liq. 3 Skin Irrit. 2 |
|||||||||
| NFPA 704: |
|