L-Aspartic acid potassium salt
- Product NameL-Aspartic acid potassium salt
- CAS1115-63-5
- CBNumberCB6778552
- MFC4H8KNO4
- MW173.21
- EINECS214-226-4
- MDL NumberMFCD00021083
- MOL File1115-63-5.mol
Chemical Properties
| refractive index | 20.5 ° (C=8, 6mol/L HCl) |
| storage temp. | Store desiccated in air-tight containers. |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 13.5±1°, c = 1% in H2O |
| Merck | 14,840 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C4H7NO4.K/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);/q;+1/p-1/t2-;/m0./s1 |
| InChIKey | TXXVQZSTAVIHFD-DKWTVANSSA-M |
| SMILES | N[C@H](C([O-])=O)CC(O)=O.[K+] |
| LogP | -0.669 (est) |
| EPA Substance Registry System | L-Aspartic acid, monopotassium salt (1115-63-5) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302-H315-H320-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | CI9458500 |
| TSCA | TSCA listed |
| HS Code | 2922499990 |
| Storage Class | 11 - Combustible Solids |