5-Azaindole
- Product Name5-Azaindole
- CAS271-34-1
- CBNumberCB6677925
- MFC7H6N2
- MW118.14
- EINECS676-348-8
- MDL NumberMFCD00955936
- MOL File271-34-1.mol
Chemical Properties
| Melting point: | 104.6-108.4°C |
| Boiling point: | 132°C/0.2mmHg(lit.) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| RTECS | UY8725000 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 15.20±0.30(Predicted) |
| color | White to Light yellow |
| Water Solubility | Hardly soluble in water. Soluble in methanol and chloroform. |
| λmax | 264nm(H2O)(lit.) |
| InChI | InChI=1S/C7H6N2/c1-4-9-7-2-3-8-5-6(1)7/h1-5,9H |
| InChIKey | SRSKXJVMVSSSHB-UHFFFAOYSA-N |
| SMILES | C1=NC=CC2NC=CC1=2 |
| CAS DataBase Reference | 271-34-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-41-37/38-22 | |||||||||
| Safety Statements | 26-36/37/39-39 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 2933990099 | |||||||||
| NFPA 704: |
|