3-Bromo-2-chlorothiophene
- Product Name3-Bromo-2-chlorothiophene
- CAS40032-73-3
- CBNumberCB6324715
- MFC4H2BrClS
- MW197.48
- MDL NumberMFCD00043883
- MOL File40032-73-3.mol
Chemical Properties
| Boiling point: | 70 °C9 mm Hg(lit.) |
| Density | 1.808 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| Specific Gravity | 1.827 |
| Water Solubility | < 0.2 g/l (20 ºC) |
| BRN | 1205539 |
| InChI | InChI=1S/C4H2BrClS/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | KSHOQKKCPJELBV-UHFFFAOYSA-N |
| SMILES | C1(Cl)SC=CC=1Br |
| CAS DataBase Reference | 40032-73-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS07,GHS06 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335-H227-H302-H312-H331 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P210e-P405-P501a-P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| RIDADR | 2810 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2934999090 | |||||||||
| NFPA 704: |
|