4-Phenylimidazole
- Product Name4-Phenylimidazole
- CAS670-95-1
- CBNumberCB6252973
- MFC9H8N2
- MW144.17
- EINECS211-580-1
- MDL NumberMFCD00005197
- MOL File670-95-1.mol
Chemical Properties
| Melting point: | 128-131 °C (lit.) |
| Boiling point: | 252.78°C (rough estimate) |
| Density | 1.1357 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetone: soluble25mg/mL, clear, colorless to yellow (typical) |
| form | powder to crystal |
| pka | 13.58±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 2969 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8(5-3-1)9-6-10-7-11-9/h1-7H,(H,10,11) |
| InChIKey | XHLKOHSAWQPOFO-UHFFFAOYSA-N |
| SMILES | C1NC(C2=CC=CC=C2)=CN=1 |
| CAS DataBase Reference | 670-95-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| HS Code | 2933290090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|