ISOPIMPINELLIN
- Product NameISOPIMPINELLIN
- CAS482-27-9
- CBNumberCB6207988
- MFC13H10O5
- MW246.22
- MDL NumberMFCD00017407
- MOL File482-27-9.mol
Chemical Properties
| Melting point: | 150-151°C |
| Boiling point: | 448.7±45.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in acetone and chloroform; |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| Water Solubility | practically insoluble in water |
| λmax | 268nm(MeOH)(lit.) |
| BRN | 262337 |
| InChI | InChI=1S/C13H10O5/c1-15-10-7-3-4-9(14)18-12(7)13(16-2)11-8(10)5-6-17-11/h3-6H,1-2H3 |
| InChIKey | DFMAXQKDIGCMTL-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=C(OC)C3OC=CC=3C(OC)=C2C=C1 |
| LogP | 1.407 (est) |
| CAS DataBase Reference | 482-27-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330 |
| Precautionary statements | P260-P262-P264-P280-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | 20/21/22-28 |
| Safety Statements | 22-36/37/39-45-36/37-28 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| RTECS | LV1049200 |
| HS Code | 2932202000 |
| Storage Class |
6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications |
Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Hazardous Substances Data | 482-27-9(Hazardous Substances Data) |
