(S)-3-Amino-3-(3-nitro-phenyl)-propionic acid
- Product Name(S)-3-Amino-3-(3-nitro-phenyl)-propionic acid
- CAS734529-57-8
- CBNumberCB6180959
- MFC9H10N2O4
- MW210.19
- EINECS200-528-9
- MDL NumberMFCD04113693
- MOL File734529-57-8.mol
Chemical Properties
| Boiling point: | 384.5±37.0 °C(Predicted) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.52±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| optical activity | Consistent with structure |
| Sensitive | Air Sensitive |
| InChI | InChI=1/C9H10N2O4/c10-8(5-9(12)13)6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/s3 |
| InChIKey | SJBFILRQMRECCK-SBYBRXNCNA-N |
| SMILES | [C@H](C1C=CC=C(N(=O)=O)C=1)(N)CC(=O)O |&1:0,r| |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| HS Code | 2922498590 | |||||||||
| NFPA 704: |
|