(S)-(+)-alpha-Methoxy-alpha-trifluoromethylphenylacetyl chloride
- Product Name(S)-(+)-alpha-Methoxy-alpha-trifluoromethylphenylacetyl chloride
- CAS39637-99-5
- CBNumberCB6170769
- MFC10H8ClF3O2
- MW252.62
- EINECS621-758-4
- MDL NumberMFCD00044400
- MOL File39637-99-5.mol
Chemical Properties
| alpha | D25 -10.0± 0.1° (neat, l = 1) |
| Boiling point: | 213-214 °C(lit.) |
| Density | 1.35 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.353 |
| optical activity | [α]20/D 137±2°, c = 6.4% in carbon tetrachloride |
| Water Solubility | Sparingly miscible with water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,6280 |
| BRN | 3591565 |
| InChI | 1S/C10H8ClF3O2/c1-16-9(8(11)15,10(12,13)14)7-5-3-2-4-6-7/h2-6H,1H3/t9-/m0/s1 |
| InChIKey | PAORVUMOXXAMPL-VIFPVBQESA-N |
| SMILES | CO[C@](C(Cl)=O)(c1ccccc1)C(F)(F)F |
| CAS DataBase Reference | 39637-99-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-27-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Corrosive/Freeze | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2918990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|