Ethyl 2-pentynoate
- Product NameEthyl 2-pentynoate
- CAS55314-57-3
- CBNumberCB6139548
- MFC7H10O2
- MW126.15
- EINECS259-588-4
- MDL NumberMFCD00015221
- MOL File55314-57-3.mol
Chemical Properties
| Boiling point: | 178-179 °C (lit.) |
| Density | 0.957 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 102 °F |
| storage temp. | 2-8°C |
| Specific Gravity | 0.957 |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Not miscible in water. |
| BRN | 1750016 |
| InChI | InChI=1S/C7H10O2/c1-3-5-6-7(8)9-4-2/h3-4H2,1-2H3 |
| InChIKey | XDPRPKSTFBPPHU-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C#CCC |
Safety
| Symbol(GHS) |
   GHS02,GHS05,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H318-H334 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338-P342+P311 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-43 | |||||||||
| Safety Statements | 16-37/39 | |||||||||
| RIDADR | UN 3272 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2916190090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Dam. 1 Flam. Liq. 3 Resp. Sens. 1 |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|