2,4-Dimethyl-3-pentanol
- Product Name2,4-Dimethyl-3-pentanol
- CAS600-36-2
- CBNumberCB6136956
- MFC7H16O
- MW116.2
- EINECS209-993-7
- MDL NumberMFCD00008921
- MOL File600-36-2.mol
Chemical Properties
| Melting point: | -70°C |
| Boiling point: | 136 °C |
| Density | 0.83 |
| refractive index | 1.43 |
| Flash point: | 37 °C |
| storage temp. | Store at room temperature |
| form | clear liquid |
| pka | 15.04±0.20(Predicted) |
| color | Colorless to Almost colorless |
| Water Solubility | 32.4 g/L (20 ºC) |
| BRN | 1731593 |
| Henry's Law Constant | 4.0×10-1 mol/(m3Pa) at 25℃, Yaffe et al. (2003) |
| InChI | InChI=1S/C7H16O/c1-5(2)7(8)6(3)4/h5-8H,1-4H3 |
| InChIKey | BAYAKMPRFGNNFW-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)C(C)C |
| LogP | 1.899 (est) |
| CAS DataBase Reference | 600-36-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pentanol, 2,4-dimethyl-(600-36-2) |
| EPA Substance Registry System | 2,4-Dimethyl-3-pentanol (600-36-2) |
Safety
| Symbol(GHS) |
   GHS02,GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H302-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P280-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 10-22-37/38-41 | |||||||||
| Safety Statements | 16-26-39 | |||||||||
| RIDADR | UN 1987 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | SA6660000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2905199090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|