3,4-Dichlorophenacyl bromide
- Product Name3,4-Dichlorophenacyl bromide
- CAS2632-10-2
- CBNumberCB5744543
- MFC8H5BrCl2O
- MW267.93
- EINECS627-992-3
- MDL NumberMFCD00051581
- MOL File2632-10-2.mol
Chemical Properties
| Melting point: | 54 °C |
| Boiling point: | 339℃ |
| Density | 1.695 |
| Flash point: | 159℃ |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 511981 |
| InChI | InChI=1S/C8H5BrCl2O/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
| InChIKey | PAKFHEFMTRCFAU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C(Cl)=C1)CBr |
| CAS DataBase Reference | 2632-10-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | Xi,T | |||||||||
| Risk Statements | 20/21/22-34-36/37-36/37/38-36-25 | |||||||||
| Safety Statements | 26-27-36/37/39-36-45 | |||||||||
| RIDADR | 1759 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Eye Irrit. 2 |
|||||||||
| NFPA 704: |
|
