4,4'-Dimethylbiphenyl
- Product Name4,4'-Dimethylbiphenyl
- CAS2905-30-8
- CBNumberCB5699221
- MFC8H9ClO2S
- MW204.67
- EINECS210-337-7
- MDL NumberMFCD00625742
- MOL File2905-30-8.mol
Chemical Properties
| Melting point: | 118-120 °C(lit.) |
| Boiling point: | 295 °C(lit.) |
| Density | 1.290 |
| storage temp. | 2-8°C |
| Appearance | Off-white to light brown Solid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C8H9ClO2S/c1-6-3-4-8(5-7(6)2)12(9,10)11/h3-5H,1-2H3 |
| InChIKey | DNMQPRPJIWTNAX-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(C)C(C)=C1 |
| CAS DataBase Reference | 2905-30-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 24/25 | |||||||||
| RIDADR | 3261 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2902909000 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|