Dansyl chloride
- Product NameDansyl chloride
- CAS605-65-2
- CBNumberCB5696240
- MFC12H12ClNO2S
- MW269.75
- EINECS210-092-6
- MDL NumberMFCD00003985
- MOL File605-65-2.mol
Chemical Properties
| Melting point: | 72-74 °C(lit.) |
| Boiling point: | 371.3±22.0 °C(Predicted) |
| Density | 1.1702 (rough estimate) |
| refractive index | 1.5630 (estimate) |
| storage temp. | 2-8°C |
| solubility | acetone: 50 mg/mL |
| form | powder and chunks |
| pka | 2.38±0.40(Predicted) |
| color | yellow to orange |
| Appearance | Yellow solid |
| Water Solubility | Soluble in dimethyl fluoride, acetone, chloroform, pyridine, benzene and dioxane. Insoluble in water. |
| Sensitive | Moisture Sensitive |
| ex/em | λex 380 nm; λem 475 nm |
| Merck | 14,2814 |
| BRN | 2217205 |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | 1S/C12H12ClNO2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3 |
| InChIKey | XPDXVDYUQZHFPV-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(cccc12)S(Cl)(=O)=O |
| CAS DataBase Reference | 605-65-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenesulfonyl chloride, 5-(dimethylamino)- (605-65-2) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H290-H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P305+P351+P338+P310 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45-3 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | QK3688000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29214980 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|